C23H24O6 — CID 54456864
2-[6-methoxy-2-methyl-3-[(2,3,4-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid (PubChem CID 54456864) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[6-methoxy-2-methyl-3-[(2,3,4-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid.
| Compound Name | 2-[6-methoxy-2-methyl-3-[(2,3,4-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 54456864 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[6-methoxy-2-methyl-3-[(2,3,4-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
| SMILES | COc1ccc2c(c1)C(CC(=O)O)=C(C)C2=Cc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C23H24O6/c1-13-17(10-14-6-9-20(27-3)23(29-5)22(14)28-4)16-8-7-15(26-2)11-19(16)18(13)12-21(24)25/h6-11H,12H2,1-5H3,(H,24,25) |
| InChIKey | WYUOAVJLGFMBLE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|