C22H21BrO5 — CID 146478126
2-[(3Z)-3-[(4-bromo-3,5-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid (PubChem CID 146478126) has the molecular formula C22H21BrO5 and a molecular weight of 445.31 g/mol. Its IUPAC name is 2-[(3Z)-3-[(4-bromo-3,5-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-3-[(4-bromo-3,5-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 146478126 |
| Molecular Formula | C22H21BrO5 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[(3Z)-3-[(4-bromo-3,5-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid |
| SMILES | COc1ccc2c(c1)C(CC(=O)O)=C(C)/C2=C/c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C22H21BrO5/c1-12-16(7-13-8-19(27-3)22(23)20(9-13)28-4)15-6-5-14(26-2)10-18(15)17(12)11-21(24)25/h5-10H,11H2,1-4H3,(H,24,25)/b16-7- |
| InChIKey | DCOSLHBWQDBWGI-APSNUPSMSA-N |
| XLogP | 5.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|