C24H26O7 — CID 135329124
2-[5,6-dimethoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid (PubChem CID 135329124) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[5,6-dimethoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid.
| Compound Name | 2-[5,6-dimethoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 135329124 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[5,6-dimethoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
| SMILES | COc1cc2c(cc1OC)C(CC(=O)O)=C(C)C2=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H26O7/c1-13-15(7-14-8-21(29-4)24(31-6)22(9-14)30-5)17-10-19(27-2)20(28-3)11-18(17)16(13)12-23(25)26/h7-11H,12H2,1-6H3,(H,25,26) |
| InChIKey | PCRDPQCSLOJXPI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|