C22H21ClO5 — CID 10172985
2-[(3Z)-6-chloro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid (PubChem CID 10172985) has the molecular formula C22H21ClO5 and a molecular weight of 400.86 g/mol. Its IUPAC name is 2-[(3Z)-6-chloro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-6-chloro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 10172985 |
| Molecular Formula | C22H21ClO5 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[(3Z)-6-chloro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
| SMILES | COc1cc(/C=C2/C(C)=C(CC(=O)O)c3cc(Cl)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C22H21ClO5/c1-12-16(7-13-8-19(26-2)22(28-4)20(9-13)27-3)15-6-5-14(23)10-18(15)17(12)11-21(24)25/h5-10H,11H2,1-4H3,(H,24,25)/b16-7- |
| InChIKey | GNNRQOVYEHCODF-APSNUPSMSA-N |
| XLogP | 5.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|