C21H19ClO4 — CID 10215739
2-[(3Z)-6-chloro-3-[(3,4-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetic acid (PubChem CID 10215739) has the molecular formula C21H19ClO4 and a molecular weight of 370.83 g/mol. Its IUPAC name is 2-[(3Z)-6-chloro-3-[(3,4-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-6-chloro-3-[(3,4-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 10215739 |
| Molecular Formula | C21H19ClO4 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[(3Z)-6-chloro-3-[(3,4-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetic acid |
| SMILES | COc1ccc(/C=C2/C(C)=C(CC(=O)O)c3cc(Cl)ccc32)cc1OC |
| InChI | InChI=1S/C21H19ClO4/c1-12-16(8-13-4-7-19(25-2)20(9-13)26-3)15-6-5-14(22)10-18(15)17(12)11-21(23)24/h4-10H,11H2,1-3H3,(H,23,24)/b16-8- |
| InChIKey | GCNPIPATYGMMDT-PXNMLYILSA-N |
| XLogP | 5.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|