C22H22O5 — CID 10150304
2-[(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid (PubChem CID 10150304) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 10150304 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-2-methylinden-1-yl]acetic acid |
| SMILES | COc1ccc2c(c1)C(CC(=O)O)=C(C)/C2=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H22O5/c1-13-17(9-14-5-8-20(26-3)21(10-14)27-4)16-7-6-15(25-2)11-19(16)18(13)12-22(23)24/h5-11H,12H2,1-4H3,(H,23,24)/b17-9- |
| InChIKey | NRZBHUAJTOQWLQ-MFOYZWKCSA-N |
| XLogP | 4.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|