C21H19ClO4S — CID 19356678
2-[(3E)-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetyl chloride (PubChem CID 19356678) has the molecular formula C21H19ClO4S and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-[(3E)-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetyl chloride.
| Compound Name | 2-[(3E)-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetyl chloride |
|---|---|
| PubChem CID | 19356678 |
| Molecular Formula | C21H19ClO4S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-[(3E)-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetyl chloride |
| SMILES | COc1ccc2c(c1)C(CC(=O)Cl)=C(C)/C2=C\c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H19ClO4S/c1-13-18(10-14-4-7-16(8-5-14)27(3,24)25)17-9-6-15(26-2)11-20(17)19(13)12-21(22)23/h4-11H,12H2,1-3H3/b18-10+ |
| InChIKey | LECQRYURZSGUSY-VCHYOVAHSA-N |
| XLogP | 4.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|