C21H21FO4S — CID 54307297
2-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethanol (PubChem CID 54307297) has the molecular formula C21H21FO4S and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethanol.
| Compound Name | 2-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethanol |
|---|---|
| PubChem CID | 54307297 |
| Molecular Formula | C21H21FO4S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethanol |
| SMILES | COc1cc2c(cc1F)C(=Cc1ccc(S(C)(=O)=O)cc1)C(C)=C2CCO |
| InChI | InChI=1S/C21H21FO4S/c1-13-16(8-9-23)19-12-21(26-2)20(22)11-18(19)17(13)10-14-4-6-15(7-5-14)27(3,24)25/h4-7,10-12,23H,8-9H2,1-3H3 |
| InChIKey | SIKOTCHSZYDQIZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|