C24H24FNO3S2 — CID 42631263
2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]-1-thiomorpholin-4-ylethanone (PubChem CID 42631263) has the molecular formula C24H24FNO3S2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]-1-thiomorpholin-4-ylethanone.
| Compound Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]-1-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 42631263 |
| Molecular Formula | C24H24FNO3S2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]-1-thiomorpholin-4-ylethanone |
| SMILES | CC1=C(CC(=O)N2CCSCC2)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H24FNO3S2/c1-16-21(13-17-3-6-19(7-4-17)31(2,28)29)20-8-5-18(25)14-23(20)22(16)15-24(27)26-9-11-30-12-10-26/h3-8,13-14H,9-12,15H2,1-2H3/b21-13- |
| InChIKey | MNTCKCWJJCCZBQ-BKUYFWCQSA-N |
| XLogP | 4.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|