C22H22FNO3S — CID 70432526
N-[2-[6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethyl]acetamide (PubChem CID 70432526) has the molecular formula C22H22FNO3S and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[2-[6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 70432526 |
| Molecular Formula | C22H22FNO3S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[2-[6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCC1=C(C)C(=Cc2ccc(S(C)(=O)=O)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C22H22FNO3S/c1-14-19(10-11-24-15(2)25)22-13-17(23)6-9-20(22)21(14)12-16-4-7-18(8-5-16)28(3,26)27/h4-9,12-13H,10-11H2,1-3H3,(H,24,25) |
| InChIKey | MIDFBRPKOFCYDE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|