C23H23FO4S — CID 173369840
4-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]butan-2-one (PubChem CID 173369840) has the molecular formula C23H23FO4S and a molecular weight of 414.50 g/mol. Its IUPAC name is 4-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]butan-2-one.
| Compound Name | 4-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]butan-2-one |
|---|---|
| PubChem CID | 173369840 |
| Molecular Formula | C23H23FO4S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-[5-fluoro-6-methoxy-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]butan-2-one |
| SMILES | COc1cc2c(cc1F)C(=Cc1ccc(S(C)(=O)=O)cc1)C(C)=C2CCC(C)=O |
| InChI | InChI=1S/C23H23FO4S/c1-14(25)5-10-18-15(2)19(20-12-22(24)23(28-3)13-21(18)20)11-16-6-8-17(9-7-16)29(4,26)27/h6-9,11-13H,5,10H2,1-4H3 |
| InChIKey | FIZHGZYTJIDABI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|