C22H20ClFO4 — CID 22457010
2-[(3E)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetyl chloride (PubChem CID 22457010) has the molecular formula C22H20ClFO4 and a molecular weight of 402.85 g/mol. Its IUPAC name is 2-[(3E)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetyl chloride.
| Compound Name | 2-[(3E)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetyl chloride |
|---|---|
| PubChem CID | 22457010 |
| Molecular Formula | C22H20ClFO4 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[(3E)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetyl chloride |
| SMILES | COc1cc(/C=C2\C(C)=C(CC(=O)Cl)c3cc(F)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C22H20ClFO4/c1-12-16(7-13-8-19(26-2)22(28-4)20(9-13)27-3)15-6-5-14(24)10-18(15)17(12)11-21(23)25/h5-10H,11H2,1-4H3/b16-7+ |
| InChIKey | NYSUAKUKEUECSZ-FRKPEAEDSA-N |
| XLogP | 5.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|