C23H23FO4 — CID 153356409
2-[4-[(Z)-(3-ethyl-5-fluoro-2-methylinden-1-ylidene)methyl]-2,6-dimethoxyphenoxy]acetaldehyde (PubChem CID 153356409) has the molecular formula C23H23FO4 and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[4-[(Z)-(3-ethyl-5-fluoro-2-methylinden-1-ylidene)methyl]-2,6-dimethoxyphenoxy]acetaldehyde.
| Compound Name | 2-[4-[(Z)-(3-ethyl-5-fluoro-2-methylinden-1-ylidene)methyl]-2,6-dimethoxyphenoxy]acetaldehyde |
|---|---|
| PubChem CID | 153356409 |
| Molecular Formula | C23H23FO4 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[4-[(Z)-(3-ethyl-5-fluoro-2-methylinden-1-ylidene)methyl]-2,6-dimethoxyphenoxy]acetaldehyde |
| SMILES | CCC1=C(C)/C(=C/c2cc(OC)c(OCC=O)c(OC)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C23H23FO4/c1-5-17-14(2)19(18-7-6-16(24)13-20(17)18)10-15-11-21(26-3)23(28-9-8-25)22(12-15)27-4/h6-8,10-13H,5,9H2,1-4H3/b19-10- |
| InChIKey | UJYLLKKFNWTPJO-GRSHGNNSSA-N |
| XLogP | 5.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|