C29H30FNO3 — CID 66570844
N-benzyl-2-[(3Z)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]ethanamine (PubChem CID 66570844) has the molecular formula C29H30FNO3 and a molecular weight of 459.56 g/mol. Its IUPAC name is N-benzyl-2-[(3Z)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]ethanamine.
| Compound Name | N-benzyl-2-[(3Z)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]ethanamine |
|---|---|
| PubChem CID | 66570844 |
| Molecular Formula | C29H30FNO3 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-benzyl-2-[(3Z)-6-fluoro-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]ethanamine |
| SMILES | COc1cc(/C=C2/C(C)=C(CCNCc3ccccc3)c3cc(F)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C29H30FNO3/c1-19-23(12-13-31-18-20-8-6-5-7-9-20)26-17-22(30)10-11-24(26)25(19)14-21-15-27(32-2)29(34-4)28(16-21)33-3/h5-11,14-17,31H,12-13,18H2,1-4H3/b25-14- |
| InChIKey | PXUIOZDYIYBCMC-QFEZKATASA-N |
| XLogP | 6.36 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|