C22H21FO5 — CID 146909263
methyl 2-[(3Z)-6-fluoro-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetate (PubChem CID 146909263) has the molecular formula C22H21FO5 and a molecular weight of 384.40 g/mol. Its IUPAC name is methyl 2-[(3Z)-6-fluoro-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetate.
| Compound Name | methyl 2-[(3Z)-6-fluoro-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetate |
|---|---|
| PubChem CID | 146909263 |
| Molecular Formula | C22H21FO5 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | methyl 2-[(3Z)-6-fluoro-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-methylinden-1-yl]acetate |
| SMILES | COC(=O)CC1=C(C)/C(=C/c2cc(OC)c(O)c(OC)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C22H21FO5/c1-12-16(7-13-8-19(26-2)22(25)20(9-13)27-3)15-6-5-14(23)10-18(15)17(12)11-21(24)28-4/h5-10,25H,11H2,1-4H3/b16-7- |
| InChIKey | AAZHRFJFVKPYSC-APSNUPSMSA-N |
| XLogP | 4.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|