C27H27FN2O3S — CID 121417845
2-[(3E)-3-[(3,5-dimethoxy-4-sulfanylphenyl)methylidene]-6-fluoro-2-methylinden-1-yl]-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 121417845) has the molecular formula C27H27FN2O3S and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[(3E)-3-[(3,5-dimethoxy-4-sulfanylphenyl)methylidene]-6-fluoro-2-methylinden-1-yl]-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[(3E)-3-[(3,5-dimethoxy-4-sulfanylphenyl)methylidene]-6-fluoro-2-methylinden-1-yl]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 121417845 |
| Molecular Formula | C27H27FN2O3S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[(3E)-3-[(3,5-dimethoxy-4-sulfanylphenyl)methylidene]-6-fluoro-2-methylinden-1-yl]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | COc1cc(/C=C2\C(C)=C(CC(=O)NCc3cccn3C)c3cc(F)ccc32)cc(OC)c1S |
| InChI | InChI=1S/C27H27FN2O3S/c1-16-21(10-17-11-24(32-3)27(34)25(12-17)33-4)20-8-7-18(28)13-23(20)22(16)14-26(31)29-15-19-6-5-9-30(19)2/h5-13,34H,14-15H2,1-4H3,(H,29,31)/b21-10+ |
| InChIKey | WNHNXEJNDCGIFC-UFFVCSGVSA-N |
| XLogP | 5.50 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|