C34H30FN3O8 — CID 121423145
[4-[(Z)-[5-fluoro-2-methyl-3-[2-[(1-methylpyrrol-2-yl)methylamino]-2-oxoethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate (PubChem CID 121423145) has the molecular formula C34H30FN3O8 and a molecular weight of 627.63 g/mol. Its IUPAC name is [4-[(Z)-[5-fluoro-2-methyl-3-[2-[(1-methylpyrrol-2-yl)methylamino]-2-oxoethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate.
| Compound Name | [4-[(Z)-[5-fluoro-2-methyl-3-[2-[(1-methylpyrrol-2-yl)methylamino]-2-oxoethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 121423145 |
| Molecular Formula | C34H30FN3O8 |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | [4-[(Z)-[5-fluoro-2-methyl-3-[2-[(1-methylpyrrol-2-yl)methylamino]-2-oxoethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate |
| SMILES | COc1cc(/C=C2/C(C)=C(CC(=O)NCc3cccn3C)c3cc(F)ccc32)cc(OC)c1OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H30FN3O8/c1-20-27(26-12-7-22(35)17-29(26)28(20)18-32(39)36-19-24-6-5-13-37(24)2)14-21-15-30(43-3)33(31(16-21)44-4)46-34(40)45-25-10-8-23(9-11-25)38(41)42/h5-17H,18-19H2,1-4H3,(H,36,39)/b27-14- |
| InChIKey | WJKHZTNOLXOTPQ-VYYCAZPPSA-N |
| XLogP | 6.70 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|