C36H32FN3O7 — CID 121422987
(4-nitrophenyl) 3-[4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]propanoate (PubChem CID 121422987) has the molecular formula C36H32FN3O7 and a molecular weight of 637.66 g/mol. Its IUPAC name is (4-nitrophenyl) 3-[4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]propanoate.
| Compound Name | (4-nitrophenyl) 3-[4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]propanoate |
|---|---|
| PubChem CID | 121422987 |
| Molecular Formula | C36H32FN3O7 |
| Molecular Weight | 637.66 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | (4-nitrophenyl) 3-[4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]propanoate |
| SMILES | COc1cc(/C=C2/C(C)=C(CC(=O)NCc3cccnc3)c3cc(F)ccc32)cc(OC)c1CCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H32FN3O7/c1-22-30(28-11-6-25(37)18-32(28)31(22)19-35(41)39-21-23-5-4-14-38-20-23)15-24-16-33(45-2)29(34(17-24)46-3)12-13-36(42)47-27-9-7-26(8-10-27)40(43)44/h4-11,14-18,20H,12-13,19,21H2,1-3H3,(H,39,41)/b30-15- |
| InChIKey | BXAUADBVNFVGCC-MNDYBZJGSA-N |
| XLogP | 6.72 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|