C35H29FN2O9 — CID 121423147
[4-[(Z)-[5-fluoro-3-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate (PubChem CID 121423147) has the molecular formula C35H29FN2O9 and a molecular weight of 640.62 g/mol. Its IUPAC name is [4-[(Z)-[5-fluoro-3-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate.
| Compound Name | [4-[(Z)-[5-fluoro-3-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 121423147 |
| Molecular Formula | C35H29FN2O9 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | [4-[(Z)-[5-fluoro-3-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] (4-nitrophenyl) carbonate |
| SMILES | COc1cccc(NC(=O)CC2=C(C)/C(=C/c3cc(OC)c(OC(=O)Oc4ccc([N+](=O)[O-])cc4)c(OC)c3)c3ccc(F)cc32)c1 |
| InChI | InChI=1S/C35H29FN2O9/c1-20-28(27-13-8-22(36)17-30(27)29(20)19-33(39)37-23-6-5-7-26(18-23)43-2)14-21-15-31(44-3)34(32(16-21)45-4)47-35(40)46-25-11-9-24(10-12-25)38(41)42/h5-18H,19H2,1-4H3,(H,37,39)/b28-14- |
| InChIKey | IFLZIGMFACDLEQ-MUXKCCDJSA-N |
| XLogP | 7.69 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|