C26H19F3O3 — CID 171428957
2-[(3Z)-3-[[3-[(2,4-difluorophenoxy)methyl]phenyl]methylidene]-6-fluoro-2-methylinden-1-yl]acetic acid (PubChem CID 171428957) has the molecular formula C26H19F3O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-[(3Z)-3-[[3-[(2,4-difluorophenoxy)methyl]phenyl]methylidene]-6-fluoro-2-methylinden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-3-[[3-[(2,4-difluorophenoxy)methyl]phenyl]methylidene]-6-fluoro-2-methylinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 171428957 |
| Molecular Formula | C26H19F3O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[(3Z)-3-[[3-[(2,4-difluorophenoxy)methyl]phenyl]methylidene]-6-fluoro-2-methylinden-1-yl]acetic acid |
| SMILES | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1cccc(COc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C26H19F3O3/c1-15-21(20-7-5-18(27)11-23(20)22(15)13-26(30)31)10-16-3-2-4-17(9-16)14-32-25-8-6-19(28)12-24(25)29/h2-12H,13-14H2,1H3,(H,30,31)/b21-10- |
| InChIKey | VOACJDOFTUCPQX-FBHDLOMBSA-N |
| XLogP | 6.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|