C28H25FO3 — CID 166887755
2-[(3Z)-6-fluoro-2-methyl-3-[[4-(4-propan-2-ylphenoxy)phenyl]methylidene]inden-1-yl]acetic acid (PubChem CID 166887755) has the molecular formula C28H25FO3 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-2-methyl-3-[[4-(4-propan-2-ylphenoxy)phenyl]methylidene]inden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-6-fluoro-2-methyl-3-[[4-(4-propan-2-ylphenoxy)phenyl]methylidene]inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 166887755 |
| Molecular Formula | C28H25FO3 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[(3Z)-6-fluoro-2-methyl-3-[[4-(4-propan-2-ylphenoxy)phenyl]methylidene]inden-1-yl]acetic acid |
| SMILES | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(Oc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H25FO3/c1-17(2)20-6-11-23(12-7-20)32-22-9-4-19(5-10-22)14-25-18(3)26(16-28(30)31)27-15-21(29)8-13-24(25)27/h4-15,17H,16H2,1-3H3,(H,30,31)/b25-14- |
| InChIKey | HUBHRECDKRQZEM-QFEZKATASA-N |
| XLogP | 7.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|