C28H24F2O3 — CID 166887870
2-[(3Z)-6-fluoro-3-[[4-(4-fluorophenoxy)phenyl]methylidene]-2-(2-methylpropyl)inden-1-yl]acetic acid (PubChem CID 166887870) has the molecular formula C28H24F2O3 and a molecular weight of 446.49 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-3-[[4-(4-fluorophenoxy)phenyl]methylidene]-2-(2-methylpropyl)inden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-6-fluoro-3-[[4-(4-fluorophenoxy)phenyl]methylidene]-2-(2-methylpropyl)inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 166887870 |
| Molecular Formula | C28H24F2O3 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[(3Z)-6-fluoro-3-[[4-(4-fluorophenoxy)phenyl]methylidene]-2-(2-methylpropyl)inden-1-yl]acetic acid |
| SMILES | CC(C)CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H24F2O3/c1-17(2)13-24-25(23-12-7-20(30)15-26(23)27(24)16-28(31)32)14-18-3-8-21(9-4-18)33-22-10-5-19(29)6-11-22/h3-12,14-15,17H,13,16H2,1-2H3,(H,31,32)/b25-14+ |
| InChIKey | MGUMPSISMMPOFW-AFUMVMLFSA-N |
| XLogP | 7.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|