C32H35NO7 — CID 135329131
2-[(3Z)-3-[[4-[[4-(dimethylamino)phenyl]methoxy]-3,5-dimethoxyphenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]acetic acid (PubChem CID 135329131) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is 2-[(3Z)-3-[[4-[[4-(dimethylamino)phenyl]methoxy]-3,5-dimethoxyphenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-3-[[4-[[4-(dimethylamino)phenyl]methoxy]-3,5-dimethoxyphenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 135329131 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 2-[(3Z)-3-[[4-[[4-(dimethylamino)phenyl]methoxy]-3,5-dimethoxyphenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]acetic acid |
| SMILES | COc1cc2c(cc1OC)/C(=C\c1cc(OC)c(OCc3ccc(N(C)C)cc3)c(OC)c1)C(C)=C2CC(=O)O |
| InChI | InChI=1S/C32H35NO7/c1-19-23(25-15-27(36-4)28(37-5)16-26(25)24(19)17-31(34)35)12-21-13-29(38-6)32(30(14-21)39-7)40-18-20-8-10-22(11-9-20)33(2)3/h8-16H,17-18H2,1-7H3,(H,34,35)/b23-12- |
| InChIKey | HFJZWBZPJKVRCO-FMCGGJTJSA-N |
| XLogP | 6.17 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|