C28H30N2O4 — CID 146478022
2-[(3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 146478022) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[(3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 146478022 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[(3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-5,6-dimethoxy-2-methylinden-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1cc2c(cc1OC)/C(=C\c1ccc(N(C)C)cc1)C(C)=C2CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C28H30N2O4/c1-18-22(13-19-8-10-20(11-9-19)30(2)3)24-14-26(32-4)27(33-5)15-25(24)23(18)16-28(31)29-17-21-7-6-12-34-21/h6-15H,16-17H2,1-5H3,(H,29,31)/b22-13- |
| InChIKey | JWQLVVTUDSDACK-XKZIYDEJSA-N |
| XLogP | 5.40 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|