C28H30NO10P — CID 121417794
[4-[(Z)-[3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenoxy]methyl dihydrogen phosphate (PubChem CID 121417794) has the molecular formula C28H30NO10P and a molecular weight of 571.52 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenoxy]methyl dihydrogen phosphate.
| Compound Name | [4-[(Z)-[3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 121417794 |
| Molecular Formula | C28H30NO10P |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [4-[(Z)-[3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenoxy]methyl dihydrogen phosphate |
| SMILES | COc1ccc2c(c1)C(CC(=O)NCc1ccco1)=C(C)/C2=C/c1cc(OC)c(OCOP(=O)(O)O)c(OC)c1 |
| InChI | InChI=1S/C28H30NO10P/c1-17-22(10-18-11-25(35-3)28(26(12-18)36-4)38-16-39-40(31,32)33)21-8-7-19(34-2)13-24(21)23(17)14-27(30)29-15-20-6-5-9-37-20/h5-13H,14-16H2,1-4H3,(H,29,30)(H2,31,32,33)/b22-10- |
| InChIKey | FZNXIFNVSNZRLU-YVNNLAQVSA-N |
| XLogP | 4.79 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|