C38H39NO5 — CID 139505517
[4-[(Z)-[3-[(E)-2-(furan-2-ylmethylamino)hex-2-enyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2-methoxy-6-methylphenyl] benzoate (PubChem CID 139505517) has the molecular formula C38H39NO5 and a molecular weight of 589.73 g/mol. Its IUPAC name is [4-[(Z)-[3-[(E)-2-(furan-2-ylmethylamino)hex-2-enyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2-methoxy-6-methylphenyl] benzoate.
| Compound Name | [4-[(Z)-[3-[(E)-2-(furan-2-ylmethylamino)hex-2-enyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2-methoxy-6-methylphenyl] benzoate |
|---|---|
| PubChem CID | 139505517 |
| Molecular Formula | C38H39NO5 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | [4-[(Z)-[3-[(E)-2-(furan-2-ylmethylamino)hex-2-enyl]-5-methoxy-2-methylinden-1-ylidene]methyl]-2-methoxy-6-methylphenyl] benzoate |
| SMILES | CCC/C=C(\CC1=C(C)/C(=C/c2cc(C)c(OC(=O)c3ccccc3)c(OC)c2)c2ccc(OC)cc21)NCc1ccco1 |
| InChI | InChI=1S/C38H39NO5/c1-6-7-14-29(39-24-31-15-11-18-43-31)22-34-26(3)33(32-17-16-30(41-4)23-35(32)34)20-27-19-25(2)37(36(21-27)42-5)44-38(40)28-12-9-8-10-13-28/h8-21,23,39H,6-7,22,24H2,1-5H3/b29-14+,33-20- |
| InChIKey | LUPUSDKFQMIZDZ-ONLIDYGYSA-N |
| XLogP | 9.02 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|