C34H30FNO6 — CID 121423209
[4-[(Z)-[5-fluoro-3-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] benzoate (PubChem CID 121423209) has the molecular formula C34H30FNO6 and a molecular weight of 567.61 g/mol. Its IUPAC name is [4-[(Z)-[5-fluoro-3-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] benzoate.
| Compound Name | [4-[(Z)-[5-fluoro-3-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 121423209 |
| Molecular Formula | C34H30FNO6 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | [4-[(Z)-[5-fluoro-3-[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenyl] benzoate |
| SMILES | COc1cc(/C=C2/C(C)=C(CC(=O)N(C)Cc3ccco3)c3cc(F)ccc32)cc(OC)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H30FNO6/c1-21-27(15-22-16-30(39-3)33(31(17-22)40-4)42-34(38)23-9-6-5-7-10-23)26-13-12-24(35)18-29(26)28(21)19-32(37)36(2)20-25-11-8-14-41-25/h5-18H,19-20H2,1-4H3/b27-15- |
| InChIKey | WXWQSVDTAJNFKZ-DICXZTSXSA-N |
| XLogP | 7.03 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|