C20H15ClO6S — CID 68834023
3-(carboxymethoxy)-4-chloro-5-(3-phenylmethoxyphenyl)thiophene-2-carboxylic acid (PubChem CID 68834023) has the molecular formula C20H15ClO6S and a molecular weight of 418.85 g/mol. Its IUPAC name is 3-(carboxymethoxy)-4-chloro-5-(3-phenylmethoxyphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-4-chloro-5-(3-phenylmethoxyphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68834023 |
| Molecular Formula | C20H15ClO6S |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 3-(carboxymethoxy)-4-chloro-5-(3-phenylmethoxyphenyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)COc1c(C(=O)O)sc(-c2cccc(OCc3ccccc3)c2)c1Cl |
| InChI | InChI=1S/C20H15ClO6S/c21-16-17(27-11-15(22)23)19(20(24)25)28-18(16)13-7-4-8-14(9-13)26-10-12-5-2-1-3-6-12/h1-9H,10-11H2,(H,22,23)(H,24,25) |
| InChIKey | XIBHYZFJWNVTCB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |