C27H29N3O2S — CID 117081019
N-(1-benzylpiperidin-4-yl)-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 117081019) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 117081019 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2ccc(C(=O)NC3CCN(Cc4ccccc4)CC3)s2)cc1 |
| InChI | InChI=1S/C27H29N3O2S/c31-26(28-22-10-11-22)21-8-6-20(7-9-21)24-12-13-25(33-24)27(32)29-23-14-16-30(17-15-23)18-19-4-2-1-3-5-19/h1-9,12-13,22-23H,10-11,14-18H2,(H,28,31)(H,29,32) |
| InChIKey | MQZCVMZVJJZNMQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |