C22H20N2O2S — CID 117090387
N-benzyl-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 117090387) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-benzyl-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-benzyl-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 117090387 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-benzyl-5-[4-(cyclopropylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2ccc(C(=O)NCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H20N2O2S/c25-21(24-18-10-11-18)17-8-6-16(7-9-17)19-12-13-20(27-19)22(26)23-14-15-4-2-1-3-5-15/h1-9,12-13,18H,10-11,14H2,(H,23,26)(H,24,25) |
| InChIKey | JCUJANFAUKHNHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |