C23H26ClN5O4S — CID 44555350
N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(2-chloro-6-methylphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide (PubChem CID 44555350) has the molecular formula C23H26ClN5O4S and a molecular weight of 504.01 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(2-chloro-6-methylphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(2-chloro-6-methylphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 44555350 |
| Molecular Formula | C23H26ClN5O4S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(2-chloro-6-methylphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CC2=C(C)CCN(NS(=O)(=O)c3c(C)cccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C23H26ClN5O4S/c1-14-10-11-29(28-34(32,33)21-15(2)4-3-5-19(21)24)23(31)18(14)12-20(30)27-13-16-6-8-17(9-7-16)22(25)26/h3-9,28H,10-13H2,1-2H3,(H3,25,26)(H,27,30) |
| InChIKey | GBTNQKZHXAJHFY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|