C24H26ClN7O3 — CID 10141518
N-[(4-carbamimidoylphenyl)methyl]-2-[4-chloro-2-(3,5-diaminophenyl)-5-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide (PubChem CID 10141518) has the molecular formula C24H26ClN7O3 and a molecular weight of 495.97 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[4-chloro-2-(3,5-diaminophenyl)-5-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[4-chloro-2-(3,5-diaminophenyl)-5-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 10141518 |
| Molecular Formula | C24H26ClN7O3 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[4-chloro-2-(3,5-diaminophenyl)-5-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CC2=C(c3cc(N)cc(N)c3)C(=O)C(Cl)=C(NN(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H26ClN7O3/c1-32(2)31-21-20(25)23(35)19(14-7-15(26)9-16(27)8-14)17(22(21)34)10-18(33)30-11-12-3-5-13(6-4-12)24(28)29/h3-9,31H,10-11,26-27H2,1-2H3,(H3,28,29)(H,30,33) |
| InChIKey | UVFSONDIROUEBD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|