C32H33N7O4 — CID 10231882
3-amino-N-benzyl-5-[2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]benzamide (PubChem CID 10231882) has the molecular formula C32H33N7O4 and a molecular weight of 579.66 g/mol. Its IUPAC name is 3-amino-N-benzyl-5-[2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]benzamide.
| Compound Name | 3-amino-N-benzyl-5-[2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]benzamide |
|---|---|
| PubChem CID | 10231882 |
| Molecular Formula | C32H33N7O4 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 3-amino-N-benzyl-5-[2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-(2,2-dimethylhydrazinyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CC2=C(c3cc(N)cc(C(=O)NCc4ccccc4)c3)C(=O)C=C(NN(C)C)C2=O)cc1 |
| InChI | InChI=1S/C32H33N7O4/c1-39(2)38-26-16-27(40)29(22-12-23(14-24(33)13-22)32(43)37-18-19-6-4-3-5-7-19)25(30(26)42)15-28(41)36-17-20-8-10-21(11-9-20)31(34)35/h3-14,16,38H,15,17-18,33H2,1-2H3,(H3,34,35)(H,36,41)(H,37,43) |
| InChIKey | CCQSGAUNDZSRKF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 183.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|