C24H30N8O2 — CID 10204982
N-[(4-carbamimidoylphenyl)methyl]-2-[2-(3,5-diaminophenyl)-5-(2-ethyl-2-methylhydrazinyl)-4-oxo-1H-pyridin-3-yl]acetamide (PubChem CID 10204982) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[2-(3,5-diaminophenyl)-5-(2-ethyl-2-methylhydrazinyl)-4-oxo-1H-pyridin-3-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[2-(3,5-diaminophenyl)-5-(2-ethyl-2-methylhydrazinyl)-4-oxo-1H-pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 10204982 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[2-(3,5-diaminophenyl)-5-(2-ethyl-2-methylhydrazinyl)-4-oxo-1H-pyridin-3-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(-c3cc(N)cc(N)c3)[nH]cc(NN(C)CC)c2=O)cc1 |
| InChI | InChI=1S/C24H30N8O2/c1-3-32(2)31-20-13-30-22(16-8-17(25)10-18(26)9-16)19(23(20)34)11-21(33)29-12-14-4-6-15(7-5-14)24(27)28/h4-10,13,31H,3,11-12,25-26H2,1-2H3,(H3,27,28)(H,29,33)(H,30,34) |
| InChIKey | ZCKCDZCHERZCNL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 179.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|