C25H29N7O4 — CID 10141266
methyl 3-amino-5-[5-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-oxo-3-(propan-2-ylamino)-1H-pyridazin-6-yl]benzoate (PubChem CID 10141266) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is methyl 3-amino-5-[5-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-oxo-3-(propan-2-ylamino)-1H-pyridazin-6-yl]benzoate.
| Compound Name | methyl 3-amino-5-[5-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-oxo-3-(propan-2-ylamino)-1H-pyridazin-6-yl]benzoate |
|---|---|
| PubChem CID | 10141266 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | methyl 3-amino-5-[5-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-oxo-3-(propan-2-ylamino)-1H-pyridazin-6-yl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(-c3cc(N)cc(C(=O)OC)c3)[nH]nc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C25H29N7O4/c1-13(2)30-24-22(34)19(11-20(33)29-12-14-4-6-15(7-5-14)23(27)28)21(31-32-24)16-8-17(25(35)36-3)10-18(26)9-16/h4-10,13H,11-12,26H2,1-3H3,(H3,27,28)(H,29,33)(H,30,32)(H,31,34) |
| InChIKey | GPTZJPWAWCJWHR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 189.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|