C30H29Cl2N7O4S — CID 10189815
2-[3-[3-amino-5-[(2-chlorophenyl)sulfamoyl]phenyl]-4-chloro-6-cyclopropylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 10189815) has the molecular formula C30H29Cl2N7O4S and a molecular weight of 654.58 g/mol. Its IUPAC name is 2-[3-[3-amino-5-[(2-chlorophenyl)sulfamoyl]phenyl]-4-chloro-6-cyclopropylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[3-[3-amino-5-[(2-chlorophenyl)sulfamoyl]phenyl]-4-chloro-6-cyclopropylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10189815 |
| Molecular Formula | C30H29Cl2N7O4S |
| Molecular Weight | 654.58 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | 2-[3-[3-amino-5-[(2-chlorophenyl)sulfamoyl]phenyl]-4-chloro-6-cyclopropylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(-c3cc(N)cc(S(=O)(=O)Nc4ccccc4Cl)c3)c(Cl)c/c(=N\C3CC3)n2O)cc1 |
| InChI | InChI=1S/C30H29Cl2N7O4S/c31-23-3-1-2-4-25(23)38-44(42,43)22-12-19(11-20(33)13-22)29-24(32)14-27(37-21-9-10-21)39(41)26(29)15-28(40)36-16-17-5-7-18(8-6-17)30(34)35/h1-8,11-14,21,38,41H,9-10,15-16,33H2,(H3,34,35)(H,36,40)/b37-27+ |
| InChIKey | OVTHPVYZQZHUKD-NXEFEZKASA-N |
| XLogP | 4.29 |
| TPSA | 188.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|