C17H19ClN4O3 — CID 58654086
N-[[4-carbamimidoyl-2-(2-hydroxyethylamino)phenyl]methyl]-3-chloro-5-hydroxybenzamide (PubChem CID 58654086) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-(2-hydroxyethylamino)phenyl]methyl]-3-chloro-5-hydroxybenzamide.
| Compound Name | N-[[4-carbamimidoyl-2-(2-hydroxyethylamino)phenyl]methyl]-3-chloro-5-hydroxybenzamide |
|---|---|
| PubChem CID | 58654086 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[[4-carbamimidoyl-2-(2-hydroxyethylamino)phenyl]methyl]-3-chloro-5-hydroxybenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(O)cc(Cl)c2)c(NCCO)c1 |
| InChI | InChI=1S/C17H19ClN4O3/c18-13-5-12(6-14(24)8-13)17(25)22-9-11-2-1-10(16(19)20)7-15(11)21-3-4-23/h1-2,5-8,21,23-24H,3-4,9H2,(H3,19,20)(H,22,25) |
| InChIKey | MRKKBPSSWMRGLI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|