C25H33ClN6O4 — CID 11634949
acetic acid;N-[[4-carbamimidoyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-2-oxoethyl]amino]phenyl]methyl]-3-chlorobenzamide (PubChem CID 11634949) has the molecular formula C25H33ClN6O4 and a molecular weight of 517.03 g/mol. Its IUPAC name is acetic acid;N-[[4-carbamimidoyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-2-oxoethyl]amino]phenyl]methyl]-3-chlorobenzamide.
| Compound Name | acetic acid;N-[[4-carbamimidoyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-2-oxoethyl]amino]phenyl]methyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 11634949 |
| Molecular Formula | C25H33ClN6O4 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | acetic acid;N-[[4-carbamimidoyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-2-oxoethyl]amino]phenyl]methyl]-3-chlorobenzamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)c2cccc(Cl)c2)c(NCC(=O)NC2CCN(C)CC2)c1 |
| InChI | InChI=1S/C23H29ClN6O2.C2H4O2/c1-30-9-7-19(8-10-30)29-21(31)14-27-20-12-15(22(25)26)5-6-17(20)13-28-23(32)16-3-2-4-18(24)11-16;1-2(3)4/h2-6,11-12,19,27H,7-10,13-14H2,1H3,(H3,25,26)(H,28,32)(H,29,31);1H3,(H,3,4) |
| InChIKey | IOJFXWFNTKBGRS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 160.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|