C26H35N5O4 — CID 11213818
N-[[4-carbamimidoyl-2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide (PubChem CID 11213818) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-[[4-carbamimidoyl-2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 11213818 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(OC)c(C)c(OC)c2)c(N(C)CC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C26H35N5O4/c1-16-22(34-3)12-19(13-23(16)35-4)26(33)29-14-18-10-9-17(25(27)28)11-21(18)31(2)15-24(32)30-20-7-5-6-8-20/h9-13,20H,5-8,14-15H2,1-4H3,(H3,27,28)(H,29,33)(H,30,32) |
| InChIKey | WVUWNKRGVQLUFX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|