C28H33N5O4 — CID 69490364
N-[[2-[[2-amino-1-(2-methylphenyl)-2-oxoethyl]-methylamino]-4-carbamimidoylphenyl]methyl]-3,5-dimethoxy-4-methylbenzamide (PubChem CID 69490364) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[[2-[[2-amino-1-(2-methylphenyl)-2-oxoethyl]-methylamino]-4-carbamimidoylphenyl]methyl]-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-[[2-[[2-amino-1-(2-methylphenyl)-2-oxoethyl]-methylamino]-4-carbamimidoylphenyl]methyl]-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 69490364 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-[[2-[[2-amino-1-(2-methylphenyl)-2-oxoethyl]-methylamino]-4-carbamimidoylphenyl]methyl]-3,5-dimethoxy-4-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(OC)c(C)c(OC)c2)c(N(C)C(C(N)=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C28H33N5O4/c1-16-8-6-7-9-21(16)25(27(31)34)33(3)22-12-18(26(29)30)10-11-19(22)15-32-28(35)20-13-23(36-4)17(2)24(14-20)37-5/h6-14,25H,15H2,1-5H3,(H3,29,30)(H2,31,34)(H,32,35) |
| InChIKey | HXKLKFYIDKTLFE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|