C27H30FN5O4 — CID 11191396
N-[[4-carbamimidoyl-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide (PubChem CID 11191396) has the molecular formula C27H30FN5O4 and a molecular weight of 507.57 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-[[4-carbamimidoyl-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 11191396 |
| Molecular Formula | C27H30FN5O4 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]phenyl]methyl]-3,5-dimethoxy-4-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(OC)c(C)c(OC)c2)c(N(C)CC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C27H30FN5O4/c1-16-23(36-3)11-19(12-24(16)37-4)27(35)31-14-18-9-8-17(26(29)30)10-22(18)33(2)15-25(34)32-21-7-5-6-20(28)13-21/h5-13H,14-15H2,1-4H3,(H3,29,30)(H,31,35)(H,32,34) |
| InChIKey | OYRXTRBOEPHURK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|