C27H38N5O4+ — CID 69491610
[5-carbamimidoyl-2-[[(3,5-dimethoxy-4-methylbenzoyl)amino]methyl]phenyl]-(cyclohexylcarbamoyl)-dimethylazanium (PubChem CID 69491610) has the molecular formula C27H38N5O4+ and a molecular weight of 496.63 g/mol. Its IUPAC name is [5-carbamimidoyl-2-[[(3,5-dimethoxy-4-methylbenzoyl)amino]methyl]phenyl]-(cyclohexylcarbamoyl)-dimethylazanium.
| Compound Name | [5-carbamimidoyl-2-[[(3,5-dimethoxy-4-methylbenzoyl)amino]methyl]phenyl]-(cyclohexylcarbamoyl)-dimethylazanium |
|---|---|
| PubChem CID | 69491610 |
| Molecular Formula | C27H38N5O4+ |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | [5-carbamimidoyl-2-[[(3,5-dimethoxy-4-methylbenzoyl)amino]methyl]phenyl]-(cyclohexylcarbamoyl)-dimethylazanium |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(OC)c(C)c(OC)c2)c([N+](C)(C)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C27H37N5O4/c1-17-23(35-4)14-20(15-24(17)36-5)26(33)30-16-19-12-11-18(25(28)29)13-22(19)32(2,3)27(34)31-21-9-7-6-8-10-21/h11-15,21H,6-10,16H2,1-5H3,(H4-,28,29,30,31,33,34)/p+1 |
| InChIKey | GNEKDAXLKDWCMB-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|