C23H26Cl2N6O4 — CID 162306640
N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-(pyridin-3-ylmethoxy)benzamide;azane;hydrochloride (PubChem CID 162306640) has the molecular formula C23H26Cl2N6O4 and a molecular weight of 521.41 g/mol. Its IUPAC name is N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-(pyridin-3-ylmethoxy)benzamide;azane;hydrochloride.
| Compound Name | N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-(pyridin-3-ylmethoxy)benzamide;azane;hydrochloride |
|---|---|
| PubChem CID | 162306640 |
| Molecular Formula | C23H26Cl2N6O4 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-(pyridin-3-ylmethoxy)benzamide;azane;hydrochloride |
| SMILES | Cl.N.[H]/N=C(\N)c1ccc(CNC(=O)c2cc(Cl)cc(OCc3cccnc3)c2)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C23H22ClN5O4.ClH.H3N/c24-18-6-17(7-19(9-18)32-12-14-2-1-5-28-10-14)23(31)29-11-16-4-3-15(22(26)27)8-20(16)33-13-21(25)30;;/h1-10H,11-13H2,(H2,25,30)(H3,26,27)(H,29,31);1H;1H3 |
| InChIKey | WFVJGEPUTUYPNO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 188.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|