C23H23F2N5O3 — CID 11226076
2-(3-anilino-2-oxo-1-pyridinyl)-N-[(4-carbamimidoyl-2,6-difluorophenyl)methyl]-2-ethoxyacetamide (PubChem CID 11226076) has the molecular formula C23H23F2N5O3 and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-(3-anilino-2-oxo-1-pyridinyl)-N-[(4-carbamimidoyl-2,6-difluorophenyl)methyl]-2-ethoxyacetamide.
| Compound Name | 2-(3-anilino-2-oxo-1-pyridinyl)-N-[(4-carbamimidoyl-2,6-difluorophenyl)methyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 11226076 |
| Molecular Formula | C23H23F2N5O3 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-(3-anilino-2-oxo-1-pyridinyl)-N-[(4-carbamimidoyl-2,6-difluorophenyl)methyl]-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(CNC(=O)C(OCC)n2cccc(Nc3ccccc3)c2=O)c(F)c1 |
| InChI | InChI=1S/C23H23F2N5O3/c1-2-33-23(21(31)28-13-16-17(24)11-14(20(26)27)12-18(16)25)30-10-6-9-19(22(30)32)29-15-7-4-3-5-8-15/h3-12,23,29H,2,13H2,1H3,(H3,26,27)(H,28,31) |
| InChIKey | RLNJRPVBYARQFG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|