C23H24FN5O4 — CID 11316953
2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxy-N-[[3-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]acetamide (PubChem CID 11316953) has the molecular formula C23H24FN5O4 and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxy-N-[[3-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]acetamide.
| Compound Name | 2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxy-N-[[3-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 11316953 |
| Molecular Formula | C23H24FN5O4 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxy-N-[[3-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]acetamide |
| SMILES | CCOC(C(=O)NCc1ccc(/C(N)=N/O)c(F)c1)n1cccc(Nc2ccccc2)c1=O |
| InChI | InChI=1S/C23H24FN5O4/c1-2-33-23(21(30)26-14-15-10-11-17(18(24)13-15)20(25)28-32)29-12-6-9-19(22(29)31)27-16-7-4-3-5-8-16/h3-13,23,27,32H,2,14H2,1H3,(H2,25,28)(H,26,30) |
| InChIKey | IDLYYWOJDXAOPJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|