C25H28N6O6 — CID 72758784
N-[[2-(2-amino-2-oxoethoxy)-4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxyacetamide (PubChem CID 72758784) has the molecular formula C25H28N6O6 and a molecular weight of 508.54 g/mol. Its IUPAC name is N-[[2-(2-amino-2-oxoethoxy)-4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxyacetamide.
| Compound Name | N-[[2-(2-amino-2-oxoethoxy)-4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 72758784 |
| Molecular Formula | C25H28N6O6 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | N-[[2-(2-amino-2-oxoethoxy)-4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2-(3-anilino-2-oxo-1-pyridinyl)-2-ethoxyacetamide |
| SMILES | CCOC(C(=O)NCc1ccc(C(N)=NO)cc1OCC(N)=O)n1cccc(Nc2ccccc2)c1=O |
| InChI | InChI=1S/C25H28N6O6/c1-2-36-25(31-12-6-9-19(24(31)34)29-18-7-4-3-5-8-18)23(33)28-14-17-11-10-16(22(27)30-35)13-20(17)37-15-21(26)32/h3-13,25,29,35H,2,14-15H2,1H3,(H2,26,32)(H2,27,30)(H,28,33) |
| InChIKey | QXIOOMYHFMMECX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 183.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|