C23H22N4O4 — CID 85199807
N-[2-[(4-ethoxybenzoyl)amino]phenyl]-3-(N'-hydroxycarbamimidoyl)benzamide (PubChem CID 85199807) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[2-[(4-ethoxybenzoyl)amino]phenyl]-3-(N'-hydroxycarbamimidoyl)benzamide.
| Compound Name | N-[2-[(4-ethoxybenzoyl)amino]phenyl]-3-(N'-hydroxycarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 85199807 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[2-[(4-ethoxybenzoyl)amino]phenyl]-3-(N'-hydroxycarbamimidoyl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccccc2NC(=O)c2cccc(C(N)=NO)c2)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-2-31-18-12-10-15(11-13-18)22(28)25-19-8-3-4-9-20(19)26-23(29)17-7-5-6-16(14-17)21(24)27-30/h3-14,30H,2H2,1H3,(H2,24,27)(H,25,28)(H,26,29) |
| InChIKey | WPGMAOLLABSNAK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|