C33H32N4O5 — CID 54437202
benzyl 4-[(4-tert-butylbenzoyl)amino]-3-[[3-(N'-hydroxycarbamimidoyl)benzoyl]amino]benzoate (PubChem CID 54437202) has the molecular formula C33H32N4O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is benzyl 4-[(4-tert-butylbenzoyl)amino]-3-[[3-(N'-hydroxycarbamimidoyl)benzoyl]amino]benzoate.
| Compound Name | benzyl 4-[(4-tert-butylbenzoyl)amino]-3-[[3-(N'-hydroxycarbamimidoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 54437202 |
| Molecular Formula | C33H32N4O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | benzyl 4-[(4-tert-butylbenzoyl)amino]-3-[[3-(N'-hydroxycarbamimidoyl)benzoyl]amino]benzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)OCc3ccccc3)cc2NC(=O)c2cccc(C(N)=NO)c2)cc1 |
| InChI | InChI=1S/C33H32N4O5/c1-33(2,3)26-15-12-22(13-16-26)30(38)35-27-17-14-25(32(40)42-20-21-8-5-4-6-9-21)19-28(27)36-31(39)24-11-7-10-23(18-24)29(34)37-41/h4-19,41H,20H2,1-3H3,(H2,34,37)(H,35,38)(H,36,39) |
| InChIKey | WLOMQQPJUGYQFT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|