C33H29N3O4 — CID 10697536
benzyl 3-[(4-tert-butylbenzoyl)amino]-4-[(3-cyanobenzoyl)amino]benzoate (PubChem CID 10697536) has the molecular formula C33H29N3O4 and a molecular weight of 531.61 g/mol. Its IUPAC name is benzyl 3-[(4-tert-butylbenzoyl)amino]-4-[(3-cyanobenzoyl)amino]benzoate.
| Compound Name | benzyl 3-[(4-tert-butylbenzoyl)amino]-4-[(3-cyanobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 10697536 |
| Molecular Formula | C33H29N3O4 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | benzyl 3-[(4-tert-butylbenzoyl)amino]-4-[(3-cyanobenzoyl)amino]benzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc(C(=O)OCc3ccccc3)ccc2NC(=O)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C33H29N3O4/c1-33(2,3)27-15-12-24(13-16-27)30(37)36-29-19-26(32(39)40-21-22-8-5-4-6-9-22)14-17-28(29)35-31(38)25-11-7-10-23(18-25)20-34/h4-19H,21H2,1-3H3,(H,35,38)(H,36,37) |
| InChIKey | ZUWAEFXDILGIEZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |