C26H27ClN4O4 — CID 169427912
4-[(4-tert-butylbenzoyl)amino]-3-[(3-carbamimidoylbenzoyl)amino]benzoic acid;hydrochloride (PubChem CID 169427912) has the molecular formula C26H27ClN4O4 and a molecular weight of 494.98 g/mol. Its IUPAC name is 4-[(4-tert-butylbenzoyl)amino]-3-[(3-carbamimidoylbenzoyl)amino]benzoic acid;hydrochloride.
| Compound Name | 4-[(4-tert-butylbenzoyl)amino]-3-[(3-carbamimidoylbenzoyl)amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 169427912 |
| Molecular Formula | C26H27ClN4O4 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 4-[(4-tert-butylbenzoyl)amino]-3-[(3-carbamimidoylbenzoyl)amino]benzoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(C(=O)Nc2cc(C(=O)O)ccc2NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H26N4O4.ClH/c1-26(2,3)19-10-7-15(8-11-19)23(31)29-20-12-9-18(25(33)34)14-21(20)30-24(32)17-6-4-5-16(13-17)22(27)28;/h4-14H,1-3H3,(H3,27,28)(H,29,31)(H,30,32)(H,33,34);1H |
| InChIKey | QLDWOWXOROSXER-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|